|
 |
|
|
| |
|
 |
HP Civil Services (Revised Pay Structure) |
| |
 |
Payment of arrears on account of revision of pay scales under the Himachal Pradesh Civil Services
(Revised Pay) Rules, 2009 08-02-12 |
| |
 |
Payment of arrears on account of revision of pay scales under the Himachal Pradesh Civil Services
(Revised Pay) Rules, 2009 24-09-11 |
|
|
|
| |
 |
Payment of arrears on account of revision of pay scales under the Himachal Pradesh Civil Services (Revised Pay) Rules, 2009 10-03-11 |
| |
 |
Payment of arrears on account of revision of pay scales
under the Himachal Pradesh Civil Services
(Revised
Pay) Rules, 2009. 02-11-10 |
| |
 |
Spl.Pay and other financial benefits from back date (No.Fin-(PR)B97)2/2001 31-05-10 |
| |
 |
Payment of arrears on account of revision of pay scales
under the Himachal Pradesh Civil Services
(Revised Pay)
Rules, 2009. 19-03-10 |
| |
 |
Revision
of Emoluments of Contract Employees
03/12/09 |
| |
 |
Fixation of Pay under Rule 7(ii)-Removal of hardship of certain categories of
employees 06/11/09 |
| |
 |
Clarification regarding Implementation of the HP Civil Services (Revised Pay) Rules, 2009 06/11/09 |
| |
 |
HP Civil Services (Revised Pay - First Amendment) Rules, 2009 13/10/09 |
| |
 |
Clarification regarding Rule-11 of the Himachal
Pradesh Civil Services (Revised Pay) Rules, 2009 19/09/09 |
| |
 |
Clarification regarding extra amount after revision of pay in the revised pay scales 09/09/09 |
| |
 |
Clarification regarding implementation of ACPS/3 or 2 tier in the revised pay scales 31/08/09 |
| |
 |
Revised Pay and Arears Calculator |
| |
 |
Himachal Pradesh Civil Services (Revised Pay) Rules, 2009 26/08/09 |
| |
 |
HP Civil Services (revised pay) Rules-Methodoly for Rounding Off 10/08/09 |
| |
|
|
| |
|
|
 |
Search
Latest Notifications |
| |
|
Clarification-letter No.Fin(PR)B(7)1/2009-III |
27-01-2012 |
| |
|
Restructing the Claim if Backwages/Arrears to 3 Years-Court Orders
15-12-2011 |
| |
|
Resotration of placement of Clerks as Junior Assistants |
| |
|
Regarding creation of posts for giving Promotion avenues
20-08-2011 |
| |
 |
Regarding grant of pay scale to Non Petitioners Statistical Asstt.in various department
w.e.f. 1.1.1986 vide Officer No. Fin(PR)B(7)13/98-III
08-11-2010 |
| |
 |
Fin(PR)B(7)13/98-Part-III, dated 3.11.2010 regarding pay scale to Statistical Asstt. in
Health Department w.e.f. 01.01.96 30-9-2010 |
| |
 |
Removal of Anomly by stepping up the way of senior Govt. employees drawing less
pay than their juniors -HP CS(Revised Pay )Rules,2009 05-10-2010 |
| |
 |
Pay scale to Auditors of Panchayati Raj w.e.f. 1986-Order No. Fin(PR)B(7)29/98 30-9-2010 |
| |
 |
Instructions regarding Implementation of Court Orders 24-9-2010 |
| |
|
| |
 |
Daily Wages |
| |
 |
Norms for fixation of emoluments of whole time contingent paid employees w.e.f 11-7-2006 |
| |
 |
Norms for fixation of emoluments of whole time contingent paid employees w.e.f. 18-5-1994 |
| |
 |
Revision of rates of Daily Wages of Daily Wagers /Part Time Workers 07-09-10 |
| |
 |
Daily Wages
Rates Revised w.e.f. 01-Mar-2009 |
| |
|
|
| |
|
|
| |
 |
Orders Relating to Grant of Interim
Relief |
| |
 |
Second Installment of Interim relief to the Employees |
| |
| |
 |
Various Orders Relating to Revision
of Pay Scales |
| |
 |
Amendment in Para 11 of the Assured Career Progression
Scheme |
|
| |
 |
Classification of Posts during 1996 Pay Revision |
| |
 |
Classification of Posts during 1978 Pay Revision |
| |
 |
Himachal
Pradesh Civil Services (Revised
Pay), Rules 1998 |
| |
|
 |
Assured Career Progression Scheme - Various Instructions |
| |
|
|
|
| |
|
|
|
| |
 |
Grant of Non-Practicing Allowance |
| |
|
 |
Grant of Non-Practicing Allowance 13-10-2005 |
| |
|
|
|
|
| |
|
|
|
|
| |
 |
Other Orders |
|
| |
|
 |
Pay scale of District Statistical Officers 07-11-2009 |
| |
|
 |
Pay Scale of Law Officers in H.P. Sectt 10-04-2008 |
| |
|
 |
Pay Scale of Food & Supply Deptt 10-10-2007 |
| |
|
 |
Sectt Allowance to the category of Mechanic Fitter in Sectt 15-9-2007 |
| |
|
 |
Pay Scale of Research Officer in IF&PE 28-08-2007 |
| |
|
 |
Grant of Sectt Allowance and Special Allowance to certain categories 6-6-2007 |
| |
|
 |
Corrigendum against Order No. Fin-(PR)B(7)-4/98 dated 14th January, 1999 7-3-2007 |
| |
|
 |
Grant of Special Allowance -Education Deptt 8-6-2007 |
| |
|
 |
Clarification regarding placement in higher pay scale 9-1-2007 |
| |
|
 |
Revision of rates of wages of daily wage Workers 15-12-2006 |
| |
|
 |
Instructions dated. 4.12.2006 in continuation of OM dated 11.7.2001 & 13.5.2002 04-12-2006 |
| |
|
 |
Clarification regarding admissibility of benefit of ACPS in case the post is filledup 04-12-2006 |
| |
|
 |
Clarification regarding fixation of pay on promotional post 17-11-2006 |
| |
|
 |
Grant of Secretariat Allowances for HP Civil Secretariat and its equivalent offices 19-10-2006 |
| |
|
 |
Revision of pay scale of cook in Panchayati Raj Deptt 20-07-2006 |
| |
|
 |
Pay scale of Cook in Health Department 18-07-2006 |
| |
|
 |
Revision of pay scale of Technical Asstt. in F&S Deptt 16-06-2006 |
| |
|
 |
Grant of Sectt Allowance for posts of Sr and Jr Scale Stenographers in Sectt 22-2-2006 |
| |
|
 |
Pay scale of Law Officer in the office of Advocate General 06-12-2005 |
| |
|
 |
Grant of Sectt Allowance for posts in Secretariat 24-8-2005 |
| |
|
 |
Revised rates of daily wages 12-8-2005 |
| |
|
 |
Pay scale Health & Family Welfare Deptt 22-2-2005 |
| |
|
 |
Petitions relating to financial matters 16-2-2005 |
| |
|
 |
H.P. Civil Services (Revised Pay)(First Amendment)Rules, 2005 08-2-2005 |
| |
|
 |
Pay scale of Judicial Officers in H.P 22-9-2003 |
| |
|
 |
Clarification regarding date of annual increment on grant of four tier pay scales 06-9-2003 |
| |
|
 |
Revision of rates of wages of daily wage Workers 18-08-2003 |
| |
|
 |
Pay Scale Urban Development Deptt. 31-12-2002 |
| |
|
 |
Revision of pay scales of Section Officers (SAS) 07-12-2002 |
| |
|
 |
Pay scale of Law Officers of H.P. Sectt 07-12-2002 |
| |
|
 |
Clarification regarding bifurcation of cadre of Clerks 26-08-2002 |
| |
|
 |
Pay Scale Local Audit Deptt. 07-08-2002 |
| |
|
 |
Revised rates of daily wages 29-07-2002 |
| |
|
 |
Revision of pay scales of certain categories of employees 14-06-2002 |
| |
|
 |
Pay Scale-Director of Education 01-06-2002 |
| |
|
 |
Pay scale TCP Deptt-II 21-05-2002 |
| |
|
 |
Pay scale TCP Deptt 21-05-2002 |
| |
|
 |
H.P. Civil Services (Revised Pay) (Fifth Amendment) Rules, 2001 18-05-2002 |
| |
|
 |
Enhancement in Sectt Allowance of various categories of Sectt 18-05-2002 |
| |
|
 |
Instructions dt. 13.5.2002 in continuation of O.M. dated 11.7.2001 13-05-2002 |
| |
|
 |
idential pay scale of feeder & promotional post-amendment in R&P 13-05-2002 |
| |
|
 |
Clarification regarding date of annual increment on placement in next higher pay scale 18-04-2002 |
| |
|
 |
Pay Scale Supdt Gr-I distt. & Sessions Judge 10-04-2002 |
| |
|
 |
Pay Scale-Police Deptt.(Wireless Orgn.) 06-03-2002 |
| |
|
 |
Pay scales H.P. Police Services 10-02-2002 |
| |
|
 |
Clarification regarding restricting the arrears back wages for a period of 3 years 15-01-2002 |
| |
|
 |
Clarification regarding bifurcation of cadre of Clerks 03-11-2001 |
| |
|
 |
Pay scale-Assistant Director (Nursing) 28-09-2001 |
| |
|
 |
Revision of rates of wages of daily wage Workers 22-09-2001 |
| |
|
 |
Clarification regarding same initial start of the feeder and promotional post 11-07-2001 |
| |
|
 |
Clarification regarding identical scale of feeder and promotional post 11-7-2001 |
| |
|
 |
Revision of Special pay to Class-IV employees who are working as Gestetnor Operators 28-06-2001 |
| |
|
 |
H.P. Civil Services (Revised Pay)(Fourth Amendment) Rules, 2001 31-05-2001 |
| |
|
 |
H.P. Civil Services (RevisedPay)(Third Amendment) Rules, 2001 31-05-2001 |
| |
|
 |
Pay scale of E-N-C PWD & IPH 07-02-2001 |
| |
|
 |
Pay Scales - I&PR Deptt 29-12-2000 |
| |
|
 |
Pay Scales-Education Deptt 21-11-2000 |
| |
|
 |
Pay Scales-Labour & Employment Deptt 19-7-2000 |
| |
|
 |
Pay Scale TCP Deptt 30-09-2000 |
| |
|
 |
Pay Scale in respect of LAC Deptt 15-09-2000 |
| |
|
 |
Grant of four tier pay scale-Instructions 23-06-2000 |
| |
|
 |
Pay scale - IGMC 27-4-2000 |
| |
|
 |
Grant of Special Allowance to IPS 4-4-2000 |
| |
|
 |
Pay Scale Fisheries Deptt. 14-01-2000 |
| |
|
 |
Pay Scale of Labour Officer 30-12-1999 |
| |
|
 |
Pay scales in respect of Ayurveda Deptt. 27-12-1999 |
| |
|
 |
Special Allowance to IAS 6-9-1999 |
| |
|
 |
Grant of Secretariat Allowance for arduous nature of duties 31-8-1999 |
| |
|
 |
Pay scale in respect of Ayurveda Deptt 16-8-1999 |
| |
|
 |
Grant of Special Allowance to HAS 28-7-1999 |
| |
|
 |
Revision of pay scales in respect of Dr. R.P. Medical college Tanda and Dental 02-7-1999 |
| |
|
 |
Revision of pay scales in respect of Teaching personnel of IGMC and RP Col 07-6-1999 |
| |
|
 |
Simplification of terms and conditions of deputation of HPAS Officers 7-5-1999 |
| |
|
 |
Grant of Secretariat Allowance to certain categories of employees 1-5-1999 |
| |
|
 |
Pay scale of Proof Reader 22-03-1999 |
| |
|
 |
Pay Scale in respect of Forest Deptt. 24-02-1999 |
| |
|
 |
Pay Scales in respect of Horticulture Deptt. 16-02-1999 |
| |
|
 |
Revision of Pay scales in respect of Technical Education Deptt. 12-02-1999 |
| |
|
 |
Revision of Pay scales in respect of TCP Deptt. 08-02-1999 |
| |
|
 |
Grant of Special Allowance and Secretariat Allowance 14-1-1999 |
| |
|
 |
Revision of rates of daily wages 07-1-1999 |
| |
|
 |
Pay Scale - Corrigendum 31-12-1998 |
| |
|
 |
H.P. Civil Services (Revised Pay) Rules, 1998-Clarification 07-11-1998 |
| |
|
 |
Grant of four tier pay scale 06-10-1998 |
| |
|
 |
Revision of rates of daily wages 13-08-1998 |
| |
|
 |
Norms for whole time contingent paid employees 30-05-1998 |
| |
|
 |
Enhancement of daily wage rates in Tribal Areas 18-04-1998 |
| |
|
 |
Revision of pay scales w.e.f. 1.1.1996 27-01-1998 |
| |
|
|
|
| |
|
|
|
|
|